C31H32N6O4S — CID 100723477
3-[(4S,5S)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide (PubChem CID 100723477) has the molecular formula C31H32N6O4S and a molecular weight of 584.70 g/mol. Its IUPAC name is 3-[(4S,5S)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide.
| Compound Name | 3-[(4S,5S)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 100723477 |
| Molecular Formula | C31H32N6O4S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 3-[(4S,5S)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1-n1c(C)cc([C@H]2[C@@H](c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2C)c1C |
| InChI | InChI=1S/C31H32N6O4S/c1-19-9-5-6-10-24(19)33-28(38)14-16-35-30(29(34-31(35)42)25-11-7-8-15-32-25)23-17-20(2)36(21(23)3)26-18-22(37(39)40)12-13-27(26)41-4/h5-13,15,17-18,29-30H,14,16H2,1-4H3,(H,33,38)(H,34,42)/t29-,30+/m1/s1 |
| InChIKey | AEOPTVHFMLZXHT-IHLOFXLRSA-N |
| XLogP | 5.72 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|