C30H29FN6O4S — CID 100698885
N-(2-fluorophenyl)-3-[(4S,5R)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100698885) has the molecular formula C30H29FN6O4S and a molecular weight of 588.67 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[(4S,5R)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[(4S,5R)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100698885 |
| Molecular Formula | C30H29FN6O4S |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | N-(2-fluorophenyl)-3-[(4S,5R)-5-[1-(2-methoxy-5-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1-n1c(C)cc([C@@H]2[C@@H](c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2F)c1C |
| InChI | InChI=1S/C30H29FN6O4S/c1-18-16-21(19(2)36(18)25-17-20(37(39)40)11-12-26(25)41-3)29-28(24-10-6-7-14-32-24)34-30(42)35(29)15-13-27(38)33-23-9-5-4-8-22(23)31/h4-12,14,16-17,28-29H,13,15H2,1-3H3,(H,33,38)(H,34,42)/t28-,29-/m1/s1 |
| InChIKey | ZPDLMQLAFLJEDI-FQLXRVMXSA-N |
| XLogP | 5.55 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|