C26H28N4O4S — CID 133155587
methyl 3-[3-[3-(2-ethoxy-2-oxoethyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 133155587) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is methyl 3-[3-[3-(2-ethoxy-2-oxoethyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 3-[3-[3-(2-ethoxy-2-oxoethyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 133155587 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | methyl 3-[3-[3-(2-ethoxy-2-oxoethyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)CN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2cccc(C(=O)OC)c2)c1C |
| InChI | InChI=1S/C26H28N4O4S/c1-5-34-22(31)15-29-24(23(28-26(29)35)21-11-6-7-12-27-21)20-13-16(2)30(17(20)3)19-10-8-9-18(14-19)25(32)33-4/h6-14,23-24H,5,15H2,1-4H3,(H,28,35) |
| InChIKey | ZQAVNNPIDFLVCY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|