C26H31N5O2S — CID 133223516
methyl 3-[3-[3-[2-(dimethylamino)ethyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 133223516) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is methyl 3-[3-[3-[2-(dimethylamino)ethyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 3-[3-[3-[2-(dimethylamino)ethyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 133223516 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | methyl 3-[3-[3-[2-(dimethylamino)ethyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3CCN(C)C)c2C)c1 |
| InChI | InChI=1S/C26H31N5O2S/c1-17-15-21(18(2)31(17)20-10-8-9-19(16-20)25(32)33-5)24-23(22-11-6-7-12-27-22)28-26(34)30(24)14-13-29(3)4/h6-12,15-16,23-24H,13-14H2,1-5H3,(H,28,34) |
| InChIKey | YAKMNVBRDUKVOJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|