C23H24N4O2S — CID 133221500
methyl 4-[2,5-dimethyl-3-(3-methyl-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl)pyrrol-1-yl]benzoate (PubChem CID 133221500) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is methyl 4-[2,5-dimethyl-3-(3-methyl-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl)pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[2,5-dimethyl-3-(3-methyl-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl)pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 133221500 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | methyl 4-[2,5-dimethyl-3-(3-methyl-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl)pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3C)c2C)cc1 |
| InChI | InChI=1S/C23H24N4O2S/c1-14-13-18(15(2)27(14)17-10-8-16(9-11-17)22(28)29-4)21-20(25-23(30)26(21)3)19-7-5-6-12-24-19/h5-13,20-21H,1-4H3,(H,25,30) |
| InChIKey | YBHJBKOZDJMSCJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|