C28H26N4O3S — CID 133183313
methyl 4-[3-[3-(2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 133183313) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is methyl 4-[3-[3-(2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[3-[3-(2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 133183313 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | methyl 4-[3-[3-(2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3c3ccccc3O)c2C)cc1 |
| InChI | InChI=1S/C28H26N4O3S/c1-17-16-21(18(2)31(17)20-13-11-19(12-14-20)27(34)35-3)26-25(22-8-6-7-15-29-22)30-28(36)32(26)23-9-4-5-10-24(23)33/h4-16,25-26,33H,1-3H3,(H,30,36) |
| InChIKey | VATRDQZMBZGDKK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|