C26H33N5OS — CID 133223269
1-[3-(dimethylamino)propyl]-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223269) has the molecular formula C26H33N5OS and a molecular weight of 463.65 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-(dimethylamino)propyl]-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223269 |
| Molecular Formula | C26H33N5OS |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3CCCN(C)C)c2C)c1 |
| InChI | InChI=1S/C26H33N5OS/c1-18-16-22(19(2)31(18)20-10-8-11-21(17-20)32-5)25-24(23-12-6-7-13-27-23)28-26(33)30(25)15-9-14-29(3)4/h6-8,10-13,16-17,24-25H,9,14-15H2,1-5H3,(H,28,33) |
| InChIKey | LYJSCLLFUTWCEQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|