C25H30FN5S — CID 133223258
1-[3-(dimethylamino)propyl]-5-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223258) has the molecular formula C25H30FN5S and a molecular weight of 451.62 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-5-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-(dimethylamino)propyl]-5-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223258 |
| Molecular Formula | C25H30FN5S |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-5-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2CCCN(C)C)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C25H30FN5S/c1-17-15-21(18(2)31(17)20-10-7-9-19(26)16-20)24-23(22-11-5-6-12-27-22)28-25(32)30(24)14-8-13-29(3)4/h5-7,9-12,15-16,23-24H,8,13-14H2,1-4H3,(H,28,32) |
| InChIKey | VREOFFMBFIEJJX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|