C24H25BrN4O2S — CID 133155500
ethyl 2-[5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 133155500) has the molecular formula C24H25BrN4O2S and a molecular weight of 513.46 g/mol. Its IUPAC name is ethyl 2-[5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 133155500 |
| Molecular Formula | C24H25BrN4O2S |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | ethyl 2-[5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C24H25BrN4O2S/c1-4-31-21(30)14-28-23(22(27-24(28)32)20-7-5-6-12-26-20)19-13-15(2)29(16(19)3)18-10-8-17(25)9-11-18/h5-13,22-23H,4,14H2,1-3H3,(H,27,32) |
| InChIKey | JKIWIZNPVREPLM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|