C23H25BrN4OS — CID 133222414
5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methoxyethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222414) has the molecular formula C23H25BrN4OS and a molecular weight of 485.45 g/mol. Its IUPAC name is 5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methoxyethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methoxyethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222414 |
| Molecular Formula | C23H25BrN4OS |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 5-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methoxyethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C23H25BrN4OS/c1-15-14-19(16(2)28(15)18-9-7-17(24)8-10-18)22-21(20-6-4-5-11-25-20)26-23(30)27(22)12-13-29-3/h4-11,14,21-22H,12-13H2,1-3H3,(H,26,30) |
| InChIKey | QOKKFRDKDJUDJU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|