C25H30N4OS — CID 133222405
5-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methoxyethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222405) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is 5-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methoxyethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methoxyethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222405 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 5-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-methoxyethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCc1ccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3CCOC)c2C)cc1 |
| InChI | InChI=1S/C25H30N4OS/c1-5-19-9-11-20(12-10-19)29-17(2)16-21(18(29)3)24-23(22-8-6-7-13-26-22)27-25(31)28(24)14-15-30-4/h6-13,16,23-24H,5,14-15H2,1-4H3,(H,27,31) |
| InChIKey | VGUMWXJRQJVNBZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|