C21H28N4O2S — CID 133155478
ethyl 2-[5-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 133155478) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is ethyl 2-[5-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[5-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 133155478 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl 2-[5-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=S)NC(c2ccccn2)C1c1cc(C)n(C(C)C)c1C |
| InChI | InChI=1S/C21H28N4O2S/c1-6-27-18(26)12-24-20(16-11-14(4)25(13(2)3)15(16)5)19(23-21(24)28)17-9-7-8-10-22-17/h7-11,13,19-20H,6,12H2,1-5H3,(H,23,28) |
| InChIKey | WLBKBNBIHJCZPQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|