C28H34N6O4S — CID 133223121
5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223121) has the molecular formula C28H34N6O4S and a molecular weight of 550.69 g/mol. Its IUPAC name is 5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223121 |
| Molecular Formula | C28H34N6O4S |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 5-[1-(2-methoxy-4-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-morpholin-4-ylpropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cc([N+](=O)[O-])ccc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2CCCN2CCOCC2)c1C |
| InChI | InChI=1S/C28H34N6O4S/c1-19-17-22(20(2)33(19)24-9-8-21(34(35)36)18-25(24)37-3)27-26(23-7-4-5-10-29-23)30-28(39)32(27)12-6-11-31-13-15-38-16-14-31/h4-5,7-10,17-18,26-27H,6,11-16H2,1-3H3,(H,30,39) |
| InChIKey | OSJWVBJBHQYRRV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|