C28H35N5OS — CID 133222942
5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222942) has the molecular formula C28H35N5OS and a molecular weight of 489.69 g/mol. Its IUPAC name is 5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222942 |
| Molecular Formula | C28H35N5OS |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3CCN3CCOCC3)c2C)c1C |
| InChI | InChI=1S/C28H35N5OS/c1-19-8-7-10-25(21(19)3)33-20(2)18-23(22(33)4)27-26(24-9-5-6-11-29-24)30-28(35)32(27)13-12-31-14-16-34-17-15-31/h5-11,18,26-27H,12-17H2,1-4H3,(H,30,35) |
| InChIKey | FQSQEHMTTQNZLF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|