C32H35N5OS — CID 133208652
3-[5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide (PubChem CID 133208652) has the molecular formula C32H35N5OS and a molecular weight of 537.73 g/mol. Its IUPAC name is 3-[5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide.
| Compound Name | 3-[5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 133208652 |
| Molecular Formula | C32H35N5OS |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 3-[5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cccc(C)c3C)c2C)cc1 |
| InChI | InChI=1S/C32H35N5OS/c1-20-12-14-25(15-13-20)34-29(38)16-18-36-31(30(35-32(36)39)27-10-6-7-17-33-27)26-19-22(3)37(24(26)5)28-11-8-9-21(2)23(28)4/h6-15,17,19,30-31H,16,18H2,1-5H3,(H,34,38)(H,35,39) |
| InChIKey | KUKDDOSEVIDSGD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|