C31H30F3N5OS — CID 100682053
3-[(4S,5S)-5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide (PubChem CID 100682053) has the molecular formula C31H30F3N5OS and a molecular weight of 577.68 g/mol. Its IUPAC name is 3-[(4S,5S)-5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide.
| Compound Name | 3-[(4S,5S)-5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 100682053 |
| Molecular Formula | C31H30F3N5OS |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 3-[(4S,5S)-5-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)cc1 |
| InChI | InChI=1S/C31H30F3N5OS/c1-19-11-13-22(14-12-19)36-27(40)15-17-38-29(28(37-30(38)41)25-9-6-7-16-35-25)23-18-20(2)39(21(23)3)26-10-5-4-8-24(26)31(32,33)34/h4-14,16,18,28-29H,15,17H2,1-3H3,(H,36,40)(H,37,41)/t28-,29+/m1/s1 |
| InChIKey | MZJPRVUYZTYGND-WDYNHAJCSA-N |
| XLogP | 6.82 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|