C32H31N5O3S2 — CID 133208153
N-[5-[5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide (PubChem CID 133208153) has the molecular formula C32H31N5O3S2 and a molecular weight of 597.77 g/mol. Its IUPAC name is N-[5-[5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 133208153 |
| Molecular Formula | C32H31N5O3S2 |
| Molecular Weight | 597.77 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | N-[5-[5-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cccc4ccccc34)c2C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C32H31N5O3S2/c1-20-18-25(21(2)36(20)28-14-9-11-22-10-5-6-12-24(22)28)31-30(26-13-7-8-17-33-26)34-32(41)37(31)23-15-16-29(40-3)27(19-23)35-42(4,38)39/h5-19,30-31,35H,1-4H3,(H,34,41) |
| InChIKey | BFBSIXBWZUYCQO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.77 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|