C30H29F3N4S — CID 133158711
5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158711) has the molecular formula C30H29F3N4S and a molecular weight of 534.65 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158711 |
| Molecular Formula | C30H29F3N4S |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(C(C)C)cc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H29F3N4S/c1-18(2)21-11-13-23(14-12-21)37-28(27(35-29(37)38)26-10-5-6-15-34-26)25-16-19(3)36(20(25)4)24-9-7-8-22(17-24)30(31,32)33/h5-18,27-28H,1-4H3,(H,35,38) |
| InChIKey | DAUQJXYLVZUWCQ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|