C30H29F3N4OS — CID 133243952
5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133243952) has the molecular formula C30H29F3N4OS and a molecular weight of 550.65 g/mol. Its IUPAC name is 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133243952 |
| Molecular Formula | C30H29F3N4OS |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 5-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(OC(C)C)cc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H29F3N4OS/c1-18(2)38-24-13-11-22(12-14-24)37-28(27(35-29(37)39)26-10-5-6-15-34-26)25-16-19(3)36(20(25)4)23-9-7-8-21(17-23)30(31,32)33/h5-18,27-28H,1-4H3,(H,35,39) |
| InChIKey | JWJPZLRBAPGARS-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|