C23H26IN5S — CID 100528883
(4R,5S)-1-(3-anilinopropyl)-5-(4-iodo-2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100528883) has the molecular formula C23H26IN5S and a molecular weight of 531.47 g/mol. Its IUPAC name is (4R,5S)-1-(3-anilinopropyl)-5-(4-iodo-2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(3-anilinopropyl)-5-(4-iodo-2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100528883 |
| Molecular Formula | C23H26IN5S |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | (4R,5S)-1-(3-anilinopropyl)-5-(4-iodo-2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1[nH]c(C)c([C@H]2[C@H](c3ccccn3)NC(=S)N2CCCNc2ccccc2)c1I |
| InChI | InChI=1S/C23H26IN5S/c1-15-19(20(24)16(2)27-15)22-21(18-11-6-7-12-26-18)28-23(30)29(22)14-8-13-25-17-9-4-3-5-10-17/h3-7,9-12,21-22,25,27H,8,13-14H2,1-2H3,(H,28,30)/t21-,22-/m0/s1 |
| InChIKey | GOKAQNFDKWGSBB-VXKWHMMOSA-N |
| XLogP | 5.11 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|