C21H22N4S2 — CID 100528402
(4R,5S)-1-(3-anilinopropyl)-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione (PubChem CID 100528402) has the molecular formula C21H22N4S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is (4R,5S)-1-(3-anilinopropyl)-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(3-anilinopropyl)-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100528402 |
| Molecular Formula | C21H22N4S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (4R,5S)-1-(3-anilinopropyl)-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@@H](c2ccccn2)[C@@H](c2cccs2)N1CCCNc1ccccc1 |
| InChI | InChI=1S/C21H22N4S2/c26-21-24-19(17-10-4-5-12-23-17)20(18-11-6-15-27-18)25(21)14-7-13-22-16-8-2-1-3-9-16/h1-6,8-12,15,19-20,22H,7,13-14H2,(H,24,26)/t19-,20+/m0/s1 |
| InChIKey | ZKUHGCILYKWMIJ-VQTJNVASSA-N |
| XLogP | 4.62 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|