C26H27N5OS — CID 100529801
(4R,5S)-1-(3-anilinopropyl)-5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100529801) has the molecular formula C26H27N5OS and a molecular weight of 457.60 g/mol. Its IUPAC name is (4R,5S)-1-(3-anilinopropyl)-5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(3-anilinopropyl)-5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100529801 |
| Molecular Formula | C26H27N5OS |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (4R,5S)-1-(3-anilinopropyl)-5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@@H](c2ccccn2)[C@@H](c2cccn2Cc2ccco2)N1CCCNc1ccccc1 |
| InChI | InChI=1S/C26H27N5OS/c33-26-29-24(22-12-4-5-14-28-22)25(23-13-6-16-30(23)19-21-11-7-18-32-21)31(26)17-8-15-27-20-9-2-1-3-10-20/h1-7,9-14,16,18,24-25,27H,8,15,17,19H2,(H,29,33)/t24-,25+/m0/s1 |
| InChIKey | BSEADPUPLMHVFL-LOSJGSFVSA-N |
| XLogP | 5.00 |
| TPSA | 58.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|