C27H26FN5S — CID 100532267
(4R,5S)-1-(3-anilinopropyl)-5-[1-(4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100532267) has the molecular formula C27H26FN5S and a molecular weight of 471.61 g/mol. Its IUPAC name is (4R,5S)-1-(3-anilinopropyl)-5-[1-(4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(3-anilinopropyl)-5-[1-(4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100532267 |
| Molecular Formula | C27H26FN5S |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (4R,5S)-1-(3-anilinopropyl)-5-[1-(4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Fc1ccc(-n2cccc2[C@@H]2[C@H](c3ccccn3)NC(=S)N2CCCNc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26FN5S/c28-20-12-14-22(15-13-20)32-18-6-11-24(32)26-25(23-10-4-5-16-30-23)31-27(34)33(26)19-7-17-29-21-8-2-1-3-9-21/h1-6,8-16,18,25-26,29H,7,17,19H2,(H,31,34)/t25-,26+/m0/s1 |
| InChIKey | ILNFQXPYKJKBOX-IZZNHLLZSA-N |
| XLogP | 5.49 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|