C29H29N5O2S — CID 100534215
methyl 2-[2-[(4R,5R)-3-(3-anilinopropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]pyrrol-1-yl]benzoate (PubChem CID 100534215) has the molecular formula C29H29N5O2S and a molecular weight of 511.65 g/mol. Its IUPAC name is methyl 2-[2-[(4R,5R)-3-(3-anilinopropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]pyrrol-1-yl]benzoate.
| Compound Name | methyl 2-[2-[(4R,5R)-3-(3-anilinopropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 100534215 |
| Molecular Formula | C29H29N5O2S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | methyl 2-[2-[(4R,5R)-3-(3-anilinopropyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1cccc1[C@H]1[C@H](c2ccccn2)NC(=S)N1CCCNc1ccccc1 |
| InChI | InChI=1S/C29H29N5O2S/c1-36-28(35)22-13-5-6-15-24(22)33-19-9-16-25(33)27-26(23-14-7-8-17-31-23)32-29(37)34(27)20-10-18-30-21-11-3-2-4-12-21/h2-9,11-17,19,26-27,30H,10,18,20H2,1H3,(H,32,37)/t26-,27-/m0/s1 |
| InChIKey | JNECZYVELJIOLY-SVBPBHIXSA-N |
| XLogP | 5.13 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|