C27H26ClN5S — CID 133242048
1-(3-anilinopropyl)-5-[1-(3-chlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133242048) has the molecular formula C27H26ClN5S and a molecular weight of 488.06 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-5-[1-(3-chlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-anilinopropyl)-5-[1-(3-chlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133242048 |
| Molecular Formula | C27H26ClN5S |
| Molecular Weight | 488.06 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 1-(3-anilinopropyl)-5-[1-(3-chlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2cccn2-c2cccc(Cl)c2)N1CCCNc1ccccc1 |
| InChI | InChI=1S/C27H26ClN5S/c28-20-9-6-12-22(19-20)32-17-7-14-24(32)26-25(23-13-4-5-15-30-23)31-27(34)33(26)18-8-16-29-21-10-2-1-3-11-21/h1-7,9-15,17,19,25-26,29H,8,16,18H2,(H,31,34) |
| InChIKey | IDMACFATDTXAQH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.06 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|