C28H28ClN5S — CID 133242139
1-(3-anilinopropyl)-5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133242139) has the molecular formula C28H28ClN5S and a molecular weight of 502.09 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-anilinopropyl)-5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133242139 |
| Molecular Formula | C28H28ClN5S |
| Molecular Weight | 502.09 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 1-(3-anilinopropyl)-5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(-n2cccc2C2C(c3ccccn3)NC(=S)N2CCCNc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C28H28ClN5S/c1-20-19-22(13-14-23(20)29)33-17-7-12-25(33)27-26(24-11-5-6-15-31-24)32-28(35)34(27)18-8-16-30-21-9-3-2-4-10-21/h2-7,9-15,17,19,26-27,30H,8,16,18H2,1H3,(H,32,35) |
| InChIKey | NKCCGGDXHROTNR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.09 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|