C24H25ClN4O2S — CID 133155885
methyl 4-[5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate (PubChem CID 133155885) has the molecular formula C24H25ClN4O2S and a molecular weight of 469.01 g/mol. Its IUPAC name is methyl 4-[5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 133155885 |
| Molecular Formula | C24H25ClN4O2S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | methyl 4-[5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=S)NC(c2ccccn2)C1c1cccn1-c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C24H25ClN4O2S/c1-16-15-17(10-11-18(16)25)28-13-5-8-20(28)23-22(19-7-3-4-12-26-19)27-24(32)29(23)14-6-9-21(30)31-2/h3-5,7-8,10-13,15,22-23H,6,9,14H2,1-2H3,(H,27,32) |
| InChIKey | WDFKVQYHWGYXLE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|