C23H22ClFN4O2S — CID 133155794
methyl 4-[5-[1-(3-chloro-4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate (PubChem CID 133155794) has the molecular formula C23H22ClFN4O2S and a molecular weight of 472.97 g/mol. Its IUPAC name is methyl 4-[5-[1-(3-chloro-4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[5-[1-(3-chloro-4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 133155794 |
| Molecular Formula | C23H22ClFN4O2S |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | methyl 4-[5-[1-(3-chloro-4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=S)NC(c2ccccn2)C1c1cccn1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C23H22ClFN4O2S/c1-31-20(30)8-5-13-29-22(21(27-23(29)32)18-6-2-3-11-26-18)19-7-4-12-28(19)15-9-10-17(25)16(24)14-15/h2-4,6-7,9-12,14,21-22H,5,8,13H2,1H3,(H,27,32) |
| InChIKey | DEBOYEWUCMUMHI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|