C23H21Cl2N3O3S — CID 133155902
methyl 4-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate (PubChem CID 133155902) has the molecular formula C23H21Cl2N3O3S and a molecular weight of 490.41 g/mol. Its IUPAC name is methyl 4-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 133155902 |
| Molecular Formula | C23H21Cl2N3O3S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | methyl 4-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C23H21Cl2N3O3S/c1-30-20(29)6-4-12-28-22(21(27-23(28)32)17-5-2-3-11-26-17)19-10-9-18(31-19)15-8-7-14(24)13-16(15)25/h2-3,5,7-11,13,21-22H,4,6,12H2,1H3,(H,27,32) |
| InChIKey | DNXKIOVBFUAZKO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|