C29H26Cl2N4O2S — CID 133218464
3-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide (PubChem CID 133218464) has the molecular formula C29H26Cl2N4O2S and a molecular weight of 565.53 g/mol. Its IUPAC name is 3-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide.
| Compound Name | 3-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 133218464 |
| Molecular Formula | C29H26Cl2N4O2S |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 3-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C29H26Cl2N4O2S/c1-2-18-7-3-4-8-22(18)33-26(36)14-16-35-28(27(34-29(35)38)23-9-5-6-15-32-23)25-13-12-24(37-25)20-11-10-19(30)17-21(20)31/h3-13,15,17,27-28H,2,14,16H2,1H3,(H,33,36)(H,34,38) |
| InChIKey | JEIIIONBBGKDGF-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|