C28H24Cl2N4O3S — CID 133209552
3-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide (PubChem CID 133209552) has the molecular formula C28H24Cl2N4O3S and a molecular weight of 567.50 g/mol. Its IUPAC name is 3-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 133209552 |
| Molecular Formula | C28H24Cl2N4O3S |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | 3-[5-[5-(2,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)CCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C28H24Cl2N4O3S/c1-36-23-8-3-2-6-20(23)32-25(35)13-15-34-27(26(33-28(34)38)21-7-4-5-14-31-21)24-12-11-22(37-24)18-10-9-17(29)16-19(18)30/h2-12,14,16,26-27H,13,15H2,1H3,(H,32,35)(H,33,38) |
| InChIKey | HGIUIGDWFMXFHE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|