C30H30N4O4S — CID 133209547
3-[5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide (PubChem CID 133209547) has the molecular formula C30H30N4O4S and a molecular weight of 542.66 g/mol. Its IUPAC name is 3-[5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-[5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 133209547 |
| Molecular Formula | C30H30N4O4S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 3-[5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide |
| SMILES | CCOc1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3CCC(=O)Nc3ccccc3OC)o2)cc1 |
| InChI | InChI=1S/C30H30N4O4S/c1-3-37-21-13-11-20(12-14-21)24-15-16-26(38-24)29-28(23-9-6-7-18-31-23)33-30(39)34(29)19-17-27(35)32-22-8-4-5-10-25(22)36-2/h4-16,18,28-29H,3,17,19H2,1-2H3,(H,32,35)(H,33,39) |
| InChIKey | YOLVYRWMVCTDEL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|