C31H32N4O3S — CID 100678079
3-[(4R,5R)-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide (PubChem CID 100678079) has the molecular formula C31H32N4O3S and a molecular weight of 540.69 g/mol. Its IUPAC name is 3-[(4R,5R)-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide.
| Compound Name | 3-[(4R,5R)-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 100678079 |
| Molecular Formula | C31H32N4O3S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 3-[(4R,5R)-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
| SMILES | CCOc1ccc(-c2ccc([C@H]3[C@H](c4ccccn4)NC(=S)N3CCC(=O)Nc3ccccc3CC)o2)cc1 |
| InChI | InChI=1S/C31H32N4O3S/c1-3-21-9-5-6-10-24(21)33-28(36)18-20-35-30(29(34-31(35)39)25-11-7-8-19-32-25)27-17-16-26(38-27)22-12-14-23(15-13-22)37-4-2/h5-17,19,29-30H,3-4,18,20H2,1-2H3,(H,33,36)(H,34,39)/t29-,30-/m0/s1 |
| InChIKey | FZWVYULDDFOMIX-KYJUHHDHSA-N |
| XLogP | 6.30 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|