C28H24FN5O5S — CID 100701084
N-(2-fluorophenyl)-3-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100701084) has the molecular formula C28H24FN5O5S and a molecular weight of 561.60 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100701084 |
| Molecular Formula | C28H24FN5O5S |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | N-(2-fluorophenyl)-3-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc([C@H]2[C@H](c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2F)o1 |
| InChI | InChI=1S/C28H24FN5O5S/c1-38-24-16-17(34(36)37)9-10-18(24)22-11-12-23(39-22)27-26(21-8-4-5-14-30-21)32-28(40)33(27)15-13-25(35)31-20-7-3-2-6-19(20)29/h2-12,14,16,26-27H,13,15H2,1H3,(H,31,35)(H,32,40)/t26-,27-/m0/s1 |
| InChIKey | DCEYONQXUZJBQB-SVBPBHIXSA-N |
| XLogP | 5.40 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|