C27H22FN5O4S — CID 100701715
N-(2-fluorophenyl)-3-[(4S,5R)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100701715) has the molecular formula C27H22FN5O4S and a molecular weight of 531.57 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[(4S,5R)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[(4S,5R)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100701715 |
| Molecular Formula | C27H22FN5O4S |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | N-(2-fluorophenyl)-3-[(4S,5R)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | O=C(CCN1C(=S)N[C@H](c2ccccn2)[C@@H]1c1ccc(-c2cccc([N+](=O)[O-])c2)o1)Nc1ccccc1F |
| InChI | InChI=1S/C27H22FN5O4S/c28-19-8-1-2-9-20(19)30-24(34)13-15-32-26(25(31-27(32)38)21-10-3-4-14-29-21)23-12-11-22(37-23)17-6-5-7-18(16-17)33(35)36/h1-12,14,16,25-26H,13,15H2,(H,30,34)(H,31,38)/t25-,26+/m1/s1 |
| InChIKey | VNJAXTJHYULFLP-FTJBHMTQSA-N |
| XLogP | 5.39 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|