C31H25N5O4S — CID 100733025
N-naphthalen-1-yl-3-[(4R,5S)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100733025) has the molecular formula C31H25N5O4S and a molecular weight of 563.64 g/mol. Its IUPAC name is N-naphthalen-1-yl-3-[(4R,5S)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-naphthalen-1-yl-3-[(4R,5S)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100733025 |
| Molecular Formula | C31H25N5O4S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | N-naphthalen-1-yl-3-[(4R,5S)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | O=C(CCN1C(=S)N[C@@H](c2ccccn2)[C@H]1c1ccc(-c2cccc([N+](=O)[O-])c2)o1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C31H25N5O4S/c37-28(33-24-13-6-8-20-7-1-2-11-23(20)24)16-18-35-30(29(34-31(35)41)25-12-3-4-17-32-25)27-15-14-26(40-27)21-9-5-10-22(19-21)36(38)39/h1-15,17,19,29-30H,16,18H2,(H,33,37)(H,34,41)/t29-,30+/m0/s1 |
| InChIKey | VPKSAFPUYOCUMR-XZWHSSHBSA-N |
| XLogP | 6.40 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|