C30H29N5O5S — CID 100678891
N-(2-ethylphenyl)-3-[(4S,5S)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100678891) has the molecular formula C30H29N5O5S and a molecular weight of 571.66 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-[(4S,5S)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-ethylphenyl)-3-[(4S,5S)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100678891 |
| Molecular Formula | C30H29N5O5S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | N-(2-ethylphenyl)-3-[(4S,5S)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)N[C@H](c2ccccn2)[C@H]1c1ccc(-c2ccc([N+](=O)[O-])cc2OC)o1 |
| InChI | InChI=1S/C30H29N5O5S/c1-3-19-8-4-5-9-22(19)32-27(36)15-17-34-29(28(33-30(34)41)23-10-6-7-16-31-23)25-14-13-24(40-25)21-12-11-20(35(37)38)18-26(21)39-2/h4-14,16,18,28-29H,3,15,17H2,1-2H3,(H,32,36)(H,33,41)/t28-,29-/m1/s1 |
| InChIKey | VNAASQGGKOOBAE-FQLXRVMXSA-N |
| XLogP | 5.82 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|