C22H19BrFN3O3S — CID 133155738
methyl 3-[5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate (PubChem CID 133155738) has the molecular formula C22H19BrFN3O3S and a molecular weight of 504.38 g/mol. Its IUPAC name is methyl 3-[5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate.
| Compound Name | methyl 3-[5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 133155738 |
| Molecular Formula | C22H19BrFN3O3S |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | methyl 3-[5-[5-(4-bromo-2-fluorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
| SMILES | COC(=O)CCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(Br)cc2F)o1 |
| InChI | InChI=1S/C22H19BrFN3O3S/c1-29-19(28)9-11-27-21(20(26-22(27)31)16-4-2-3-10-25-16)18-8-7-17(30-18)14-6-5-13(23)12-15(14)24/h2-8,10,12,20-21H,9,11H2,1H3,(H,26,31) |
| InChIKey | YEWIUJZYBDFHQZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|