C22H20N4O5S — CID 133155763
methyl 3-[5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate (PubChem CID 133155763) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is methyl 3-[5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate.
| Compound Name | methyl 3-[5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 133155763 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | methyl 3-[5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
| SMILES | COC(=O)CCN1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C22H20N4O5S/c1-30-19(27)11-13-25-21(20(24-22(25)32)16-4-2-3-12-23-16)18-10-9-17(31-18)14-5-7-15(8-6-14)26(28)29/h2-10,12,20-21H,11,13H2,1H3,(H,24,32) |
| InChIKey | SUZPFMCZEQNMCO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|