C26H22N4O4S — CID 133181352
1-[(4-methoxyphenyl)methyl]-5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133181352) has the molecular formula C26H22N4O4S and a molecular weight of 486.55 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133181352 |
| Molecular Formula | C26H22N4O4S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(CN2C(=S)NC(c3ccccn3)C2c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C26H22N4O4S/c1-33-20-11-5-17(6-12-20)16-29-25(24(28-26(29)35)21-4-2-3-15-27-21)23-14-13-22(34-23)18-7-9-19(10-8-18)30(31)32/h2-15,24-25H,16H2,1H3,(H,28,35) |
| InChIKey | FNQASHCNXUWEIF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|