C26H24FN5O2S — CID 133208780
N-(4-fluorophenyl)-3-[5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 133208780) has the molecular formula C26H24FN5O2S and a molecular weight of 489.58 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(4-fluorophenyl)-3-[5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 133208780 |
| Molecular Formula | C26H24FN5O2S |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | N-(4-fluorophenyl)-3-[5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | O=C(CCN1C(=S)NC(c2ccccn2)C1c1cccn1Cc1ccco1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN5O2S/c27-18-8-10-19(11-9-18)29-23(33)12-15-32-25(24(30-26(32)35)21-6-1-2-13-28-21)22-7-3-14-31(22)17-20-5-4-16-34-20/h1-11,13-14,16,24-25H,12,15,17H2,(H,29,33)(H,30,35) |
| InChIKey | QYYIYIRNADUEQH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|