C27H33N5S — CID 133242172
1-(3-anilinopropyl)-5-(1-cyclohexylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133242172) has the molecular formula C27H33N5S and a molecular weight of 459.66 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-5-(1-cyclohexylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-anilinopropyl)-5-(1-cyclohexylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133242172 |
| Molecular Formula | C27H33N5S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 1-(3-anilinopropyl)-5-(1-cyclohexylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2ccn(C3CCCCC3)c2)N1CCCNc1ccccc1 |
| InChI | InChI=1S/C27H33N5S/c33-27-30-25(24-14-7-8-16-29-24)26(21-15-19-31(20-21)23-12-5-2-6-13-23)32(27)18-9-17-28-22-10-3-1-4-11-22/h1,3-4,7-8,10-11,14-16,19-20,23,25-26,28H,2,5-6,9,12-13,17-18H2,(H,30,33) |
| InChIKey | VFDZRDHGBWXYTR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|