C21H28N4S — CID 133221834
5-(1-cyclohexylpyrrol-3-yl)-1-propan-2-yl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133221834) has the molecular formula C21H28N4S and a molecular weight of 368.55 g/mol. Its IUPAC name is 5-(1-cyclohexylpyrrol-3-yl)-1-propan-2-yl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(1-cyclohexylpyrrol-3-yl)-1-propan-2-yl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133221834 |
| Molecular Formula | C21H28N4S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 5-(1-cyclohexylpyrrol-3-yl)-1-propan-2-yl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC(C)N1C(=S)NC(c2ccccn2)C1c1ccn(C2CCCCC2)c1 |
| InChI | InChI=1S/C21H28N4S/c1-15(2)25-20(19(23-21(25)26)18-10-6-7-12-22-18)16-11-13-24(14-16)17-8-4-3-5-9-17/h6-7,10-15,17,19-20H,3-5,8-9H2,1-2H3,(H,23,26) |
| InChIKey | BXJDFOADAJEPDK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|