C26H30N4S — CID 133158686
5-(1-cyclohexylpyrrol-3-yl)-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158686) has the molecular formula C26H30N4S and a molecular weight of 430.62 g/mol. Its IUPAC name is 5-(1-cyclohexylpyrrol-3-yl)-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(1-cyclohexylpyrrol-3-yl)-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158686 |
| Molecular Formula | C26H30N4S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 5-(1-cyclohexylpyrrol-3-yl)-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccn(C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C26H30N4S/c1-2-19-11-13-22(14-12-19)30-25(24(28-26(30)31)23-10-6-7-16-27-23)20-15-17-29(18-20)21-8-4-3-5-9-21/h6-7,10-18,21,24-25H,2-5,8-9H2,1H3,(H,28,31) |
| InChIKey | XBLVMCHGXBZMDE-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|