C22H28N4S — CID 100527705
(4R,5S)-1-cyclopentyl-5-(1-cyclopentylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100527705) has the molecular formula C22H28N4S and a molecular weight of 380.56 g/mol. Its IUPAC name is (4R,5S)-1-cyclopentyl-5-(1-cyclopentylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-cyclopentyl-5-(1-cyclopentylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100527705 |
| Molecular Formula | C22H28N4S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (4R,5S)-1-cyclopentyl-5-(1-cyclopentylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@@H](c2ccccn2)[C@H](c2ccn(C3CCCC3)c2)N1C1CCCC1 |
| InChI | InChI=1S/C22H28N4S/c27-22-24-20(19-11-5-6-13-23-19)21(26(22)18-9-3-4-10-18)16-12-14-25(15-16)17-7-1-2-8-17/h5-6,11-15,17-18,20-21H,1-4,7-10H2,(H,24,27)/t20-,21-/m0/s1 |
| InChIKey | QZDGPIKWBNRVPC-SFTDATJTSA-N |
| XLogP | 4.91 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|