C32H33N5O2S — CID 100540092
N-[4-[(4S,5R)-5-(1-cyclohexylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide (PubChem CID 100540092) has the molecular formula C32H33N5O2S and a molecular weight of 551.72 g/mol. Its IUPAC name is N-[4-[(4S,5R)-5-(1-cyclohexylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[(4S,5R)-5-(1-cyclohexylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 100540092 |
| Molecular Formula | C32H33N5O2S |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | N-[4-[(4S,5R)-5-(1-cyclohexylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@H]2c2ccn(C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C32H33N5O2S/c38-29(22-39-27-11-5-2-6-12-27)34-24-14-16-26(17-15-24)37-31(30(35-32(37)40)28-13-7-8-19-33-28)23-18-20-36(21-23)25-9-3-1-4-10-25/h2,5-8,11-21,25,30-31H,1,3-4,9-10,22H2,(H,34,38)(H,35,40)/t30-,31-/m1/s1 |
| InChIKey | COPIBQDLZIQHNC-FIRIVFDPSA-N |
| XLogP | 6.58 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|