C26H22N4O2S2 — CID 100534579
2-phenoxy-N-[4-[(4S,5S)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]phenyl]acetamide (PubChem CID 100534579) has the molecular formula C26H22N4O2S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-phenoxy-N-[4-[(4S,5S)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | 2-phenoxy-N-[4-[(4S,5S)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 100534579 |
| Molecular Formula | C26H22N4O2S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-phenoxy-N-[4-[(4S,5S)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]phenyl]acetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C26H22N4O2S2/c31-23(17-32-20-7-2-1-3-8-20)28-18-11-13-19(14-12-18)30-25(22-10-6-16-34-22)24(29-26(30)33)21-9-4-5-15-27-21/h1-16,24-25H,17H2,(H,28,31)(H,29,33)/t24-,25-/m1/s1 |
| InChIKey | RWMWVDBMNFOWPN-JWQCQUIFSA-N |
| XLogP | 5.34 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|