C21H20N4OS2 — CID 100655423
2-[(4R,5S)-5-(3-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 100655423) has the molecular formula C21H20N4OS2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[(4R,5S)-5-(3-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(4R,5S)-5-(3-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 100655423 |
| Molecular Formula | C21H20N4OS2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[(4R,5S)-5-(3-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | Cc1ccsc1[C@@H]1[C@H](c2ccccn2)NC(=S)N1CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H20N4OS2/c1-14-10-12-28-20(14)19-18(16-9-5-6-11-22-16)24-21(27)25(19)13-17(26)23-15-7-3-2-4-8-15/h2-12,18-19H,13H2,1H3,(H,23,26)(H,24,27)/t18-,19-/m0/s1 |
| InChIKey | IWXBBQNKSDEDKL-OALUTQOASA-N |
| XLogP | 4.06 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|