C18H22N4O2S — CID 133155915
methyl 4-[5-(1-methylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate (PubChem CID 133155915) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is methyl 4-[5-(1-methylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[5-(1-methylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 133155915 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | methyl 4-[5-(1-methylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=S)NC(c2ccccn2)C1c1ccn(C)c1 |
| InChI | InChI=1S/C18H22N4O2S/c1-21-11-8-13(12-21)17-16(14-6-3-4-9-19-14)20-18(25)22(17)10-5-7-15(23)24-2/h3-4,6,8-9,11-12,16-17H,5,7,10H2,1-2H3,(H,20,25) |
| InChIKey | KSOBXRFFVMJBHN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|