C16H20N4OS — CID 133222498
1-(2-methoxyethyl)-5-(1-methylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222498) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-(1-methylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(2-methoxyethyl)-5-(1-methylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222498 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(2-methoxyethyl)-5-(1-methylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCN1C(=S)NC(c2ccccn2)C1c1ccn(C)c1 |
| InChI | InChI=1S/C16H20N4OS/c1-19-8-6-12(11-19)15-14(13-5-3-4-7-17-13)18-16(22)20(15)9-10-21-2/h3-8,11,14-15H,9-10H2,1-2H3,(H,18,22) |
| InChIKey | SJIZSRGANOOAMU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|